C20H23N3O3 — CID 23642529
N'-[(E)-benzylideneamino]-N-(2-hydroxyphenyl)heptanediamide (PubChem CID 23642529) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is N'-[(E)-benzylideneamino]-N-(2-hydroxyphenyl)heptanediamide.
| Compound Name | N'-[(E)-benzylideneamino]-N-(2-hydroxyphenyl)heptanediamide |
|---|---|
| PubChem CID | 23642529 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N'-[(E)-benzylideneamino]-N-(2-hydroxyphenyl)heptanediamide |
| SMILES | O=C(CCCCCC(=O)Nc1ccccc1O)N/N=C/c1ccccc1 |
| InChI | InChI=1S/C20H23N3O3/c24-18-12-8-7-11-17(18)22-19(25)13-5-2-6-14-20(26)23-21-15-16-9-3-1-4-10-16/h1,3-4,7-12,15,24H,2,5-6,13-14H2,(H,22,25)(H,23,26)/b21-15+ |
| InChIKey | DSXZBFNSYOQFQG-RCCKNPSSSA-N |
| XLogP | 3.43 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|