C19H27N3O3 — CID 44507497
N-(2-hydroxyphenyl)-N'-[(E)-pent-4-enylideneamino]octanediamide (PubChem CID 44507497) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-N'-[(E)-pent-4-enylideneamino]octanediamide.
| Compound Name | N-(2-hydroxyphenyl)-N'-[(E)-pent-4-enylideneamino]octanediamide |
|---|---|
| PubChem CID | 44507497 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-(2-hydroxyphenyl)-N'-[(E)-pent-4-enylideneamino]octanediamide |
| SMILES | C=CCC/C=N/NC(=O)CCCCCCC(=O)Nc1ccccc1O |
| InChI | InChI=1S/C19H27N3O3/c1-2-3-10-15-20-22-19(25)14-7-5-4-6-13-18(24)21-16-11-8-9-12-17(16)23/h2,8-9,11-12,15,23H,1,3-7,10,13-14H2,(H,21,24)(H,22,25)/b20-15+ |
| InChIKey | WTHONBTVRFKAAH-HMMYKYKNSA-N |
| XLogP | 3.74 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|