C21H24N4O6 — CID 44507727
N'-[(E)-(5-hydroxy-2-nitrophenyl)methylideneamino]-N-(2-hydroxyphenyl)octanediamide (PubChem CID 44507727) has the molecular formula C21H24N4O6 and a molecular weight of 428.45 g/mol. Its IUPAC name is N'-[(E)-(5-hydroxy-2-nitrophenyl)methylideneamino]-N-(2-hydroxyphenyl)octanediamide.
| Compound Name | N'-[(E)-(5-hydroxy-2-nitrophenyl)methylideneamino]-N-(2-hydroxyphenyl)octanediamide |
|---|---|
| PubChem CID | 44507727 |
| Molecular Formula | C21H24N4O6 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N'-[(E)-(5-hydroxy-2-nitrophenyl)methylideneamino]-N-(2-hydroxyphenyl)octanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1ccccc1O)N/N=C/c1cc(O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H24N4O6/c26-16-11-12-18(25(30)31)15(13-16)14-22-24-21(29)10-4-2-1-3-9-20(28)23-17-7-5-6-8-19(17)27/h5-8,11-14,26-27H,1-4,9-10H2,(H,23,28)(H,24,29)/b22-14+ |
| InChIKey | QRQVDKXCFNLALA-HYARGMPZSA-N |
| XLogP | 3.44 |
| TPSA | 154.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|