C22H27N3O3 — CID 44507510
N-(2-hydroxyphenyl)-N'-[(E)-(2-methylphenyl)methylideneamino]octanediamide (PubChem CID 44507510) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-N'-[(E)-(2-methylphenyl)methylideneamino]octanediamide.
| Compound Name | N-(2-hydroxyphenyl)-N'-[(E)-(2-methylphenyl)methylideneamino]octanediamide |
|---|---|
| PubChem CID | 44507510 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-(2-hydroxyphenyl)-N'-[(E)-(2-methylphenyl)methylideneamino]octanediamide |
| SMILES | Cc1ccccc1/C=N/NC(=O)CCCCCCC(=O)Nc1ccccc1O |
| InChI | InChI=1S/C22H27N3O3/c1-17-10-6-7-11-18(17)16-23-25-22(28)15-5-3-2-4-14-21(27)24-19-12-8-9-13-20(19)26/h6-13,16,26H,2-5,14-15H2,1H3,(H,24,27)(H,25,28)/b23-16+ |
| InChIKey | HJHCELYDBFOQDU-XQNSMLJCSA-N |
| XLogP | 4.13 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|