C19H23N3O7S — CID 44507513
5-[(E)-[[8-(2-hydroxyanilino)-8-oxooctanoyl]hydrazinylidene]methyl]furan-2-sulfonic acid (PubChem CID 44507513) has the molecular formula C19H23N3O7S and a molecular weight of 437.47 g/mol. Its IUPAC name is 5-[(E)-[[8-(2-hydroxyanilino)-8-oxooctanoyl]hydrazinylidene]methyl]furan-2-sulfonic acid.
| Compound Name | 5-[(E)-[[8-(2-hydroxyanilino)-8-oxooctanoyl]hydrazinylidene]methyl]furan-2-sulfonic acid |
|---|---|
| PubChem CID | 44507513 |
| Molecular Formula | C19H23N3O7S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 5-[(E)-[[8-(2-hydroxyanilino)-8-oxooctanoyl]hydrazinylidene]methyl]furan-2-sulfonic acid |
| SMILES | O=C(CCCCCCC(=O)Nc1ccccc1O)N/N=C/c1ccc(S(=O)(=O)O)o1 |
| InChI | InChI=1S/C19H23N3O7S/c23-16-8-6-5-7-15(16)21-17(24)9-3-1-2-4-10-18(25)22-20-13-14-11-12-19(29-14)30(26,27)28/h5-8,11-13,23H,1-4,9-10H2,(H,21,24)(H,22,25)(H,26,27,28)/b20-13+ |
| InChIKey | POCVLIPCMICUCW-DEDYPNTBSA-N |
| XLogP | 2.66 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|