C18H20Br2N4O4 — CID 3286052
N,N'-bis[(5-bromofuran-2-yl)methylideneamino]octanediamide (PubChem CID 3286052) has the molecular formula C18H20Br2N4O4 and a molecular weight of 516.19 g/mol. Its IUPAC name is N,N'-bis[(5-bromofuran-2-yl)methylideneamino]octanediamide.
| Compound Name | N,N'-bis[(5-bromofuran-2-yl)methylideneamino]octanediamide |
|---|---|
| PubChem CID | 3286052 |
| Molecular Formula | C18H20Br2N4O4 |
| Molecular Weight | 516.19 g/mol |
| Exact Mass | 513.99 |
| IUPAC Name | N,N'-bis[(5-bromofuran-2-yl)methylideneamino]octanediamide |
| SMILES | O=C(CCCCCCC(=O)NN=Cc1ccc(Br)o1)NN=Cc1ccc(Br)o1 |
| InChI | InChI=1S/C18H20Br2N4O4/c19-15-9-7-13(27-15)11-21-23-17(25)5-3-1-2-4-6-18(26)24-22-12-14-8-10-16(20)28-14/h7-12H,1-6H2,(H,23,25)(H,24,26) |
| InChIKey | MHNJBYHPHLWGFU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 109.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.19 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|