C12H18O5S2 — CID 123592456
6-(benzenesulfonyl)hexane-1-sulfonic acid (PubChem CID 123592456) has the molecular formula C12H18O5S2 and a molecular weight of 306.40 g/mol. Its IUPAC name is 6-(benzenesulfonyl)hexane-1-sulfonic acid.
| Compound Name | 6-(benzenesulfonyl)hexane-1-sulfonic acid |
|---|---|
| PubChem CID | 123592456 |
| Molecular Formula | C12H18O5S2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 6-(benzenesulfonyl)hexane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H18O5S2/c13-18(14,12-8-4-3-5-9-12)10-6-1-2-7-11-19(15,16)17/h3-5,8-9H,1-2,6-7,10-11H2,(H,15,16,17) |
| InChIKey | AJUHNDDVSOAOGG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|