C11H15FO5S2 — CID 123168445
5-(4-fluorophenyl)sulfonylpentane-1-sulfonic acid (PubChem CID 123168445) has the molecular formula C11H15FO5S2 and a molecular weight of 310.37 g/mol. Its IUPAC name is 5-(4-fluorophenyl)sulfonylpentane-1-sulfonic acid.
| Compound Name | 5-(4-fluorophenyl)sulfonylpentane-1-sulfonic acid |
|---|---|
| PubChem CID | 123168445 |
| Molecular Formula | C11H15FO5S2 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 5-(4-fluorophenyl)sulfonylpentane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCCS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H15FO5S2/c12-10-4-6-11(7-5-10)18(13,14)8-2-1-3-9-19(15,16)17/h4-7H,1-3,8-9H2,(H,15,16,17) |
| InChIKey | XLABROCSQHIUFY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|