C9H13FO5SSi — CID 140697839
3-(4-fluorophenyl)sulfonylpropyl-tritritiooxysilane (PubChem CID 140697839) has the molecular formula C9H13FO5SSi and a molecular weight of 286.37 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfonylpropyl-tritritiooxysilane.
| Compound Name | 3-(4-fluorophenyl)sulfonylpropyl-tritritiooxysilane |
|---|---|
| PubChem CID | 140697839 |
| Molecular Formula | C9H13FO5SSi |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 3-(4-fluorophenyl)sulfonylpropyl-tritritiooxysilane |
| SMILES | [3H]O[Si](CCCS(=O)(=O)c1ccc(F)cc1)(O[3H])O[3H] |
| InChI | InChI=1S/C9H13FO5SSi/c10-8-2-4-9(5-3-8)16(11,12)6-1-7-17(13,14)15/h2-5,13-15H,1,6-7H2/i13T,14T,15T |
| InChIKey | WEZPSUFHQOJMGH-MXCNDZKMSA-N |
| XLogP | -0.09 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|