C17H17F3N2O4S — CID 49202160
N-[2-(benzenesulfonamido)phenyl]-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 49202160) has the molecular formula C17H17F3N2O4S and a molecular weight of 402.39 g/mol. Its IUPAC name is N-[2-(benzenesulfonamido)phenyl]-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[2-(benzenesulfonamido)phenyl]-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 49202160 |
| Molecular Formula | C17H17F3N2O4S |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | N-[2-(benzenesulfonamido)phenyl]-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | O=C(CCOCC(F)(F)F)Nc1ccccc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H17F3N2O4S/c18-17(19,20)12-26-11-10-16(23)21-14-8-4-5-9-15(14)22-27(24,25)13-6-2-1-3-7-13/h1-9,22H,10-12H2,(H,21,23) |
| InChIKey | HURJWOAGLIEJIB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|