C11H17N3O3S — CID 43710881
4-amino-N-[2-(methanesulfonamido)phenyl]butanamide (PubChem CID 43710881) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 4-amino-N-[2-(methanesulfonamido)phenyl]butanamide.
| Compound Name | 4-amino-N-[2-(methanesulfonamido)phenyl]butanamide |
|---|---|
| PubChem CID | 43710881 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-amino-N-[2-(methanesulfonamido)phenyl]butanamide |
| SMILES | CS(=O)(=O)Nc1ccccc1NC(=O)CCCN |
| InChI | InChI=1S/C11H17N3O3S/c1-18(16,17)14-10-6-3-2-5-9(10)13-11(15)7-4-8-12/h2-3,5-6,14H,4,7-8,12H2,1H3,(H,13,15) |
| InChIKey | FISFOYVSPPMGPI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |