C10H16ClN3O3S — CID 119704021
N-[2-(methanesulfonamido)phenyl]-2-(methylamino)acetamide;hydrochloride (PubChem CID 119704021) has the molecular formula C10H16ClN3O3S and a molecular weight of 293.78 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)phenyl]-2-(methylamino)acetamide;hydrochloride.
| Compound Name | N-[2-(methanesulfonamido)phenyl]-2-(methylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119704021 |
| Molecular Formula | C10H16ClN3O3S |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-[2-(methanesulfonamido)phenyl]-2-(methylamino)acetamide;hydrochloride |
| SMILES | CNCC(=O)Nc1ccccc1NS(C)(=O)=O.Cl |
| InChI | InChI=1S/C10H15N3O3S.ClH/c1-11-7-10(14)12-8-5-3-4-6-9(8)13-17(2,15)16;/h3-6,11,13H,7H2,1-2H3,(H,12,14);1H |
| InChIKey | PHFYJVDMVFIQNK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |