C18H18ClF3N2O — CID 119340819
N-[2-(3,4,5-trifluorophenyl)phenyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 119340819) has the molecular formula C18H18ClF3N2O and a molecular weight of 370.80 g/mol. Its IUPAC name is N-[2-(3,4,5-trifluorophenyl)phenyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | N-[2-(3,4,5-trifluorophenyl)phenyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119340819 |
| Molecular Formula | C18H18ClF3N2O |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[2-(3,4,5-trifluorophenyl)phenyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1ccccc1-c1cc(F)c(F)c(F)c1)C1CCNCC1 |
| InChI | InChI=1S/C18H17F3N2O.ClH/c19-14-9-12(10-15(20)17(14)21)13-3-1-2-4-16(13)23-18(24)11-5-7-22-8-6-11;/h1-4,9-11,22H,5-8H2,(H,23,24);1H |
| InChIKey | KSJCHSXWJRFDCD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|