C36H40N4O4 — CID 16733769
N-[4-[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]phenyl]phenyl]-N'-phenylmethoxyoctanediamide (PubChem CID 16733769) has the molecular formula C36H40N4O4 and a molecular weight of 592.74 g/mol. Its IUPAC name is N-[4-[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]phenyl]phenyl]-N'-phenylmethoxyoctanediamide.
| Compound Name | N-[4-[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]phenyl]phenyl]-N'-phenylmethoxyoctanediamide |
|---|---|
| PubChem CID | 16733769 |
| Molecular Formula | C36H40N4O4 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | N-[4-[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]phenyl]phenyl]-N'-phenylmethoxyoctanediamide |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)Nc1ccccc1-c1ccc(NC(=O)CCCCCCC(=O)NOCc2ccccc2)cc1 |
| InChI | InChI=1S/C36H40N4O4/c37-32(25-27-13-5-3-6-14-27)36(43)39-33-18-12-11-17-31(33)29-21-23-30(24-22-29)38-34(41)19-9-1-2-10-20-35(42)40-44-26-28-15-7-4-8-16-28/h3-8,11-18,21-24,32H,1-2,9-10,19-20,25-26,37H2,(H,38,41)(H,39,43)(H,40,42)/t32-/m0/s1 |
| InChIKey | ZWHNWGJCVUHXKH-YTTGMZPUSA-N |
| XLogP | 6.39 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|