C13H21N2O2+ — CID 59535547
[6-oxo-6-(phenylmethoxyamino)hexyl]azanium (PubChem CID 59535547) has the molecular formula C13H21N2O2+ and a molecular weight of 237.32 g/mol. Its IUPAC name is [6-oxo-6-(phenylmethoxyamino)hexyl]azanium.
| Compound Name | [6-oxo-6-(phenylmethoxyamino)hexyl]azanium |
|---|---|
| PubChem CID | 59535547 |
| Molecular Formula | C13H21N2O2+ |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | [6-oxo-6-(phenylmethoxyamino)hexyl]azanium |
| SMILES | [NH3+]CCCCCC(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C13H20N2O2/c14-10-6-2-5-9-13(16)15-17-11-12-7-3-1-4-8-12/h1,3-4,7-8H,2,5-6,9-11,14H2,(H,15,16)/p+1 |
| InChIKey | QZXXPIJAYMKWSC-UHFFFAOYSA-O |
| XLogP | 1.04 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|