C12H16ClN2O2- — CID 59535535
chloro-[5-oxo-5-(phenylmethoxyamino)pentyl]azanide (PubChem CID 59535535) has the molecular formula C12H16ClN2O2- and a molecular weight of 255.72 g/mol. Its IUPAC name is chloro-[5-oxo-5-(phenylmethoxyamino)pentyl]azanide.
| Compound Name | chloro-[5-oxo-5-(phenylmethoxyamino)pentyl]azanide |
|---|---|
| PubChem CID | 59535535 |
| Molecular Formula | C12H16ClN2O2- |
| Molecular Weight | 255.72 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | chloro-[5-oxo-5-(phenylmethoxyamino)pentyl]azanide |
| SMILES | O=C(CCCC[N-]Cl)NOCc1ccccc1 |
| InChI | InChI=1S/C12H16ClN2O2/c13-14-9-5-4-8-12(16)15-17-10-11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10H2,(H,15,16)/q-1 |
| InChIKey | WYYWUGNCIONSIE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.72 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|