About 8-amino-N-phenylmethoxyoctanamide;ethane;ethene
8-amino-N-phenylmethoxyoctanamide;ethane;ethene (PubChem CID 143768165) has the molecular formula C19H34N2O2
and a molecular weight of 322.49 g/mol. Its IUPAC name is 8-amino-N-phenylmethoxyoctanamide;ethane;ethene.
Molecular Properties
| Compound Name | 8-amino-N-phenylmethoxyoctanamide;ethane;ethene |
| PubChem CID | 143768165 |
| Molecular Formula | C19H34N2O2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.26 |
| IUPAC Name | 8-amino-N-phenylmethoxyoctanamide;ethane;ethene |
| SMILES | C=C.CC.NCCCCCCCC(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C15H24N2O2.C2H6.C2H4/c16-12-8-3-1-2-7-11-15(18)17-19-13-14-9-5-4-6-10-14;2*1-2/h4-6,9-10H,1-3,7-8,11-13,16H2,(H,17,18);1-2H3;1-2H2 |
| InChIKey | CJNRUSOHCSQAGX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-N-phenylmethoxyoctanamide;ethane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-N-phenylmethoxyoctanamide;ethane;ethene?
The IUPAC name of 8-amino-N-phenylmethoxyoctanamide;ethane;ethene (CID 143768165) is 8-amino-N-phenylmethoxyoctanamide;ethane;ethene.
What is the SMILES notation for 8-amino-N-phenylmethoxyoctanamide;ethane;ethene?
The canonical SMILES for 8-amino-N-phenylmethoxyoctanamide;ethane;ethene is C=C.CC.NCCCCCCCC(=O)NOCc1ccccc1.
What is the InChIKey of 8-amino-N-phenylmethoxyoctanamide;ethane;ethene?
The InChIKey is CJNRUSOHCSQAGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2.C2H6.C2H4/c16-12-8-3-1-2-7-11-15(18)17-19-13-14-9-5-4-6-10-14;2*1-2/h4-6,9-10H,1-3,7-8,11-13,16H2,(H,17,18);1-2H3;1-2H2.
What are the key properties of 8-amino-N-phenylmethoxyoctanamide;ethane;ethene?
8-amino-N-phenylmethoxyoctanamide;ethane;ethene has a molecular weight of 322.49 g/mol, XLogP of 4.36, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-N-phenylmethoxyoctanamide;ethane;ethene is sourced from PubChem (CID 143768165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).