C22H26N2O4 — CID 23900156
N-(4-formylphenyl)-N'-phenylmethoxyoctanediamide (PubChem CID 23900156) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-(4-formylphenyl)-N'-phenylmethoxyoctanediamide.
| Compound Name | N-(4-formylphenyl)-N'-phenylmethoxyoctanediamide |
|---|---|
| PubChem CID | 23900156 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N-(4-formylphenyl)-N'-phenylmethoxyoctanediamide |
| SMILES | O=Cc1ccc(NC(=O)CCCCCCC(=O)NOCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H26N2O4/c25-16-18-12-14-20(15-13-18)23-21(26)10-6-1-2-7-11-22(27)24-28-17-19-8-4-3-5-9-19/h3-5,8-9,12-16H,1-2,6-7,10-11,17H2,(H,23,26)(H,24,27) |
| InChIKey | UECIIUVNNFNAIZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|