C21H27N3O3 — CID 72946637
(2S)-2-amino-N-phenyl-N'-phenylmethoxyoctanediamide (PubChem CID 72946637) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is (2S)-2-amino-N-phenyl-N'-phenylmethoxyoctanediamide.
| Compound Name | (2S)-2-amino-N-phenyl-N'-phenylmethoxyoctanediamide |
|---|---|
| PubChem CID | 72946637 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (2S)-2-amino-N-phenyl-N'-phenylmethoxyoctanediamide |
| SMILES | N[C@@H](CCCCCC(=O)NOCc1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H27N3O3/c22-19(21(26)23-18-12-6-2-7-13-18)14-8-3-9-15-20(25)24-27-16-17-10-4-1-5-11-17/h1-2,4-7,10-13,19H,3,8-9,14-16,22H2,(H,23,26)(H,24,25)/t19-/m0/s1 |
| InChIKey | JRJOZJSLTSODLI-IBGZPJMESA-N |
| XLogP | 3.15 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|