C18H30N4O3 — CID 24824516
N'-hydroxy-N-phenyloctanediamide;piperazine (PubChem CID 24824516) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is N'-hydroxy-N-phenyloctanediamide;piperazine.
| Compound Name | N'-hydroxy-N-phenyloctanediamide;piperazine |
|---|---|
| PubChem CID | 24824516 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | N'-hydroxy-N-phenyloctanediamide;piperazine |
| SMILES | C1CNCCN1.O=C(CCCCCCC(=O)Nc1ccccc1)NO |
| InChI | InChI=1S/C14H20N2O3.C4H10N2/c17-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(18)16-19;1-2-6-4-3-5-1/h3-5,8-9,19H,1-2,6-7,10-11H2,(H,15,17)(H,16,18);5-6H,1-4H2 |
| InChIKey | WPZBSLTUQJMNMS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|