C16H25NO — CID 68837139
7,7-dimethyl-N-phenyloctanamide (PubChem CID 68837139) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 7,7-dimethyl-N-phenyloctanamide.
| Compound Name | 7,7-dimethyl-N-phenyloctanamide |
|---|---|
| PubChem CID | 68837139 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 7,7-dimethyl-N-phenyloctanamide |
| SMILES | CC(C)(C)CCCCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H25NO/c1-16(2,3)13-9-5-8-12-15(18)17-14-10-6-4-7-11-14/h4,6-7,10-11H,5,8-9,12-13H2,1-3H3,(H,17,18) |
| InChIKey | ZXXFGWOTYHARIC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|