C15H20F3NO3 — CID 122391197
9,9,9-trifluoro-8,8-dihydroxy-N-phenylnonanamide (PubChem CID 122391197) has the molecular formula C15H20F3NO3 and a molecular weight of 319.32 g/mol. Its IUPAC name is 9,9,9-trifluoro-8,8-dihydroxy-N-phenylnonanamide.
| Compound Name | 9,9,9-trifluoro-8,8-dihydroxy-N-phenylnonanamide |
|---|---|
| PubChem CID | 122391197 |
| Molecular Formula | C15H20F3NO3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 9,9,9-trifluoro-8,8-dihydroxy-N-phenylnonanamide |
| SMILES | O=C(CCCCCCC(O)(O)C(F)(F)F)Nc1ccccc1 |
| InChI | InChI=1S/C15H20F3NO3/c16-15(17,18)14(21,22)11-7-2-1-6-10-13(20)19-12-8-4-3-5-9-12/h3-5,8-9,21-22H,1-2,6-7,10-11H2,(H,19,20) |
| InChIKey | DOVGAPNVSPZBAT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|