C22H23N3O3S — CID 60510936
benzyl N-[4-[[4-(2-methylphenyl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]carbamate (PubChem CID 60510936) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is benzyl N-[4-[[4-(2-methylphenyl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[[4-(2-methylphenyl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 60510936 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | benzyl N-[4-[[4-(2-methylphenyl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]carbamate |
| SMILES | Cc1ccccc1-c1csc(NC(=O)CCCNC(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C22H23N3O3S/c1-16-8-5-6-11-18(16)19-15-29-21(24-19)25-20(26)12-7-13-23-22(27)28-14-17-9-3-2-4-10-17/h2-6,8-11,15H,7,12-14H2,1H3,(H,23,27)(H,24,25,26) |
| InChIKey | XVWWDOSSHVXHFH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|