C18H23N3O3S — CID 22170600
benzyl N-[4-oxo-4-[(5-propan-2-yl-1,3-thiazol-2-yl)amino]butyl]carbamate (PubChem CID 22170600) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is benzyl N-[4-oxo-4-[(5-propan-2-yl-1,3-thiazol-2-yl)amino]butyl]carbamate.
| Compound Name | benzyl N-[4-oxo-4-[(5-propan-2-yl-1,3-thiazol-2-yl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 22170600 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | benzyl N-[4-oxo-4-[(5-propan-2-yl-1,3-thiazol-2-yl)amino]butyl]carbamate |
| SMILES | CC(C)c1cnc(NC(=O)CCCNC(=O)OCc2ccccc2)s1 |
| InChI | InChI=1S/C18H23N3O3S/c1-13(2)15-11-20-17(25-15)21-16(22)9-6-10-19-18(23)24-12-14-7-4-3-5-8-14/h3-5,7-8,11,13H,6,9-10,12H2,1-2H3,(H,19,23)(H,20,21,22) |
| InChIKey | OIFMOBGGTYCAHN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|