C22H22N4O4 — CID 56520901
benzyl N-[4-[[2-(3-hydroxyphenyl)pyrimidin-5-yl]amino]-4-oxobutyl]carbamate (PubChem CID 56520901) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is benzyl N-[4-[[2-(3-hydroxyphenyl)pyrimidin-5-yl]amino]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[[2-(3-hydroxyphenyl)pyrimidin-5-yl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 56520901 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | benzyl N-[4-[[2-(3-hydroxyphenyl)pyrimidin-5-yl]amino]-4-oxobutyl]carbamate |
| SMILES | O=C(CCCNC(=O)OCc1ccccc1)Nc1cnc(-c2cccc(O)c2)nc1 |
| InChI | InChI=1S/C22H22N4O4/c27-19-9-4-8-17(12-19)21-24-13-18(14-25-21)26-20(28)10-5-11-23-22(29)30-15-16-6-2-1-3-7-16/h1-4,6-9,12-14,27H,5,10-11,15H2,(H,23,29)(H,26,28) |
| InChIKey | OVYZGMWTGBJLKH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|