C24H29N3O4 — CID 55892585
benzyl N-[4-oxo-4-[3-(piperidine-1-carbonyl)anilino]butyl]carbamate (PubChem CID 55892585) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is benzyl N-[4-oxo-4-[3-(piperidine-1-carbonyl)anilino]butyl]carbamate.
| Compound Name | benzyl N-[4-oxo-4-[3-(piperidine-1-carbonyl)anilino]butyl]carbamate |
|---|---|
| PubChem CID | 55892585 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | benzyl N-[4-oxo-4-[3-(piperidine-1-carbonyl)anilino]butyl]carbamate |
| SMILES | O=C(CCCNC(=O)OCc1ccccc1)Nc1cccc(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C24H29N3O4/c28-22(13-8-14-25-24(30)31-18-19-9-3-1-4-10-19)26-21-12-7-11-20(17-21)23(29)27-15-5-2-6-16-27/h1,3-4,7,9-12,17H,2,5-6,8,13-16,18H2,(H,25,30)(H,26,28) |
| InChIKey | HVNVTBHQLSEKHF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|