C22H32N4O4 — CID 55822163
benzyl N-[4-oxo-4-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]butyl]carbamate (PubChem CID 55822163) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is benzyl N-[4-oxo-4-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-oxo-4-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]butyl]carbamate |
|---|---|
| PubChem CID | 55822163 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | benzyl N-[4-oxo-4-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]butyl]carbamate |
| SMILES | O=C(NCCCC(=O)N1CCN(CC(=O)N2CCCC2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C22H32N4O4/c27-20(9-6-10-23-22(29)30-18-19-7-2-1-3-8-19)26-15-13-24(14-16-26)17-21(28)25-11-4-5-12-25/h1-3,7-8H,4-6,9-18H2,(H,23,29) |
| InChIKey | IAECLIQTTPLWET-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|