C34H56N6O12 — CID 118895151
2-[4,7-bis(carboxymethyl)-10-[2-oxo-2-[3-[2-[2-[3-(phenylmethoxycarbonylamino)propoxy]ethoxy]ethoxy]propylamino]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 118895151) has the molecular formula C34H56N6O12 and a molecular weight of 740.85 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-oxo-2-[3-[2-[2-[3-(phenylmethoxycarbonylamino)propoxy]ethoxy]ethoxy]propylamino]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-oxo-2-[3-[2-[2-[3-(phenylmethoxycarbonylamino)propoxy]ethoxy]ethoxy]propylamino]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 118895151 |
| Molecular Formula | C34H56N6O12 |
| Molecular Weight | 740.85 g/mol |
| Exact Mass | 740.40 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-oxo-2-[3-[2-[2-[3-(phenylmethoxycarbonylamino)propoxy]ethoxy]ethoxy]propylamino]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)NCCCOCCOCCOCCCNC(=O)OCc2ccccc2)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C34H56N6O12/c41-30(24-37-10-12-38(25-31(42)43)14-16-40(27-33(46)47)17-15-39(13-11-37)26-32(44)45)35-8-4-18-49-20-22-51-23-21-50-19-5-9-36-34(48)52-28-29-6-2-1-3-7-29/h1-3,6-7H,4-5,8-28H2,(H,35,41)(H,36,48)(H,42,43)(H,44,45)(H,46,47) |
| InChIKey | MMHDQTIKALPCFN-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 219.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.85 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|