C37H52N6O11 — CID 118103274
2-[4,7-bis(carboxymethyl)-10-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 118103274) has the molecular formula C37H52N6O11 and a molecular weight of 756.85 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 118103274 |
| Molecular Formula | C37H52N6O11 |
| Molecular Weight | 756.85 g/mol |
| Exact Mass | 756.37 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)NCCOCCOCCNC(=O)OCC2c3ccccc3-c3ccccc32)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C37H52N6O11/c44-33(23-40-11-13-41(24-34(45)46)15-17-43(26-36(49)50)18-16-42(14-12-40)25-35(47)48)38-9-19-52-21-22-53-20-10-39-37(51)54-27-32-30-7-3-1-5-28(30)29-6-2-4-8-31(29)32/h1-8,32H,9-27H2,(H,38,44)(H,39,51)(H,45,46)(H,47,48)(H,49,50) |
| InChIKey | NYGYLQJCJCWQBE-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 210.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.85 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|