C28H36N2O7 — CID 154704999
6-[3-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]propanoylamino]hexanoic acid (PubChem CID 154704999) has the molecular formula C28H36N2O7 and a molecular weight of 512.60 g/mol. Its IUPAC name is 6-[3-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]propanoylamino]hexanoic acid.
| Compound Name | 6-[3-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 154704999 |
| Molecular Formula | C28H36N2O7 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 6-[3-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]propanoylamino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H36N2O7/c31-26(29-14-7-1-2-12-27(32)33)13-16-35-18-19-36-17-15-30-28(34)37-20-25-23-10-5-3-8-21(23)22-9-4-6-11-24(22)25/h3-6,8-11,25H,1-2,7,12-20H2,(H,29,31)(H,30,34)(H,32,33) |
| InChIKey | JFGMBGKZCYZOEJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|