C31H35BrN2O5 — CID 164944106
9H-fluoren-9-ylmethyl N-[2-[4-[4-(4-bromophenoxy)butylamino]-4-oxobutoxy]ethyl]carbamate (PubChem CID 164944106) has the molecular formula C31H35BrN2O5 and a molecular weight of 595.53 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-[4-[4-(4-bromophenoxy)butylamino]-4-oxobutoxy]ethyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-[4-[4-(4-bromophenoxy)butylamino]-4-oxobutoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 164944106 |
| Molecular Formula | C31H35BrN2O5 |
| Molecular Weight | 595.53 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-[4-[4-(4-bromophenoxy)butylamino]-4-oxobutoxy]ethyl]carbamate |
| SMILES | O=C(CCCOCCNC(=O)OCC1c2ccccc2-c2ccccc21)NCCCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C31H35BrN2O5/c32-23-13-15-24(16-14-23)38-20-6-5-17-33-30(35)12-7-19-37-21-18-34-31(36)39-22-29-27-10-3-1-8-25(27)26-9-2-4-11-28(26)29/h1-4,8-11,13-16,29H,5-7,12,17-22H2,(H,33,35)(H,34,36) |
| InChIKey | RLZOQDAPCOWRLN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|