C28H37N3O7 — CID 170354243
3-[2-[2-[[(2S)-2-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl]amino]ethoxy]ethoxy]propanoic acid (PubChem CID 170354243) has the molecular formula C28H37N3O7 and a molecular weight of 527.62 g/mol. Its IUPAC name is 3-[2-[2-[[(2S)-2-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl]amino]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[[(2S)-2-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl]amino]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 170354243 |
| Molecular Formula | C28H37N3O7 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 3-[2-[2-[[(2S)-2-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl]amino]ethoxy]ethoxy]propanoic acid |
| SMILES | N[C@@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCCOCCOCCC(=O)O |
| InChI | InChI=1S/C28H37N3O7/c29-25(27(34)30-14-16-37-18-17-36-15-12-26(32)33)11-5-6-13-31-28(35)38-19-24-22-9-3-1-7-20(22)21-8-2-4-10-23(21)24/h1-4,7-10,24-25H,5-6,11-19,29H2,(H,30,34)(H,31,35)(H,32,33)/t25-/m0/s1 |
| InChIKey | IIOXDGMLENSNBV-VWLOTQADSA-N |
| XLogP | 2.65 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|