C25H29N3O7 — CID 155427273
6-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]oxyacetyl]amino]hexanoic acid (PubChem CID 155427273) has the molecular formula C25H29N3O7 and a molecular weight of 483.52 g/mol. Its IUPAC name is 6-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]oxyacetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]oxyacetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 155427273 |
| Molecular Formula | C25H29N3O7 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 6-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]oxyacetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CONC(=O)CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H29N3O7/c29-22(28-35-16-23(30)26-13-7-1-2-12-24(31)32)14-27-25(33)34-15-21-19-10-5-3-8-17(19)18-9-4-6-11-20(18)21/h3-6,8-11,21H,1-2,7,12-16H2,(H,26,30)(H,27,33)(H,28,29)(H,31,32) |
| InChIKey | YZESQYOIVQKAQD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|