C25H30N6O7 — CID 90385969
9H-fluoren-9-ylmethyl N-[2-[2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]ethylamino]-2-oxoethoxy]carbamate (PubChem CID 90385969) has the molecular formula C25H30N6O7 and a molecular weight of 526.55 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-[2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]ethylamino]-2-oxoethoxy]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-[2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]ethylamino]-2-oxoethoxy]carbamate |
|---|---|
| PubChem CID | 90385969 |
| Molecular Formula | C25H30N6O7 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-[2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]ethylamino]-2-oxoethoxy]carbamate |
| SMILES | NCC(=O)NCC(=O)NCC(=O)NCCNC(=O)CONC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H30N6O7/c26-11-21(32)29-13-23(34)30-12-22(33)27-9-10-28-24(35)15-38-31-25(36)37-14-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,20H,9-15,26H2,(H,27,33)(H,28,35)(H,29,32)(H,30,34)(H,31,36) |
| InChIKey | YEPWPDHSOVOKHL-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 189.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|