C30H55N7O13 — CID 177035736
2-[[2-oxo-2-[3-[2-[2-[3-[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]propoxy]ethoxy]ethoxy]propylamino]ethyl]amino]acetic acid (PubChem CID 177035736) has the molecular formula C30H55N7O13 and a molecular weight of 721.81 g/mol. Its IUPAC name is 2-[[2-oxo-2-[3-[2-[2-[3-[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]propoxy]ethoxy]ethoxy]propylamino]ethyl]amino]acetic acid.
| Compound Name | 2-[[2-oxo-2-[3-[2-[2-[3-[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]propoxy]ethoxy]ethoxy]propylamino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 177035736 |
| Molecular Formula | C30H55N7O13 |
| Molecular Weight | 721.81 g/mol |
| Exact Mass | 721.39 |
| IUPAC Name | 2-[[2-oxo-2-[3-[2-[2-[3-[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]propoxy]ethoxy]ethoxy]propylamino]ethyl]amino]acetic acid |
| SMILES | O=C(O)CNCC(=O)NCCCOCCOCCOCCCNC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C30H55N7O13/c38-25(19-31-20-27(40)41)32-3-1-13-48-15-17-50-18-16-49-14-2-4-33-26(39)21-34-5-7-35(22-28(42)43)9-11-37(24-30(46)47)12-10-36(8-6-34)23-29(44)45/h31H,1-24H2,(H,32,38)(H,33,39)(H,40,41)(H,42,43)(H,44,45)(H,46,47) |
| InChIKey | WXQHPVRHMOROTM-UHFFFAOYSA-N |
| XLogP | -3.80 |
| TPSA | 260.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.81 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|