C23H28ClN3O3 — CID 55821651
benzyl N-[4-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-4-oxobutyl]carbamate (PubChem CID 55821651) has the molecular formula C23H28ClN3O3 and a molecular weight of 429.95 g/mol. Its IUPAC name is benzyl N-[4-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55821651 |
| Molecular Formula | C23H28ClN3O3 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | benzyl N-[4-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-4-oxobutyl]carbamate |
| SMILES | O=C(NCCCC(=O)N1CCN(Cc2cccc(Cl)c2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C23H28ClN3O3/c24-21-9-4-8-20(16-21)17-26-12-14-27(15-13-26)22(28)10-5-11-25-23(29)30-18-19-6-2-1-3-7-19/h1-4,6-9,16H,5,10-15,17-18H2,(H,25,29) |
| InChIKey | SBKSNEKBRMAFDJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|