C13H17ClN2O2 — CID 110399100
methyl 4-[(3-chlorophenyl)methyl]piperazine-1-carboxylate (PubChem CID 110399100) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is methyl 4-[(3-chlorophenyl)methyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[(3-chlorophenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110399100 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | methyl 4-[(3-chlorophenyl)methyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C13H17ClN2O2/c1-18-13(17)16-7-5-15(6-8-16)10-11-3-2-4-12(14)9-11/h2-4,9H,5-8,10H2,1H3 |
| InChIKey | FGGKMFPIMPRVBF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |