C22H25F2N3O5S — CID 55874885
benzyl N-[4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-4-oxobutyl]carbamate (PubChem CID 55874885) has the molecular formula C22H25F2N3O5S and a molecular weight of 481.52 g/mol. Its IUPAC name is benzyl N-[4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55874885 |
| Molecular Formula | C22H25F2N3O5S |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | benzyl N-[4-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-4-oxobutyl]carbamate |
| SMILES | O=C(NCCCC(=O)N1CCN(S(=O)(=O)c2ccc(F)cc2F)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C22H25F2N3O5S/c23-18-8-9-20(19(24)15-18)33(30,31)27-13-11-26(12-14-27)21(28)7-4-10-25-22(29)32-16-17-5-2-1-3-6-17/h1-3,5-6,8-9,15H,4,7,10-14,16H2,(H,25,29) |
| InChIKey | PFGGNUBLLMCDAX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|