C21H21F4N3O4S — CID 26418691
N-[4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 26418691) has the molecular formula C21H21F4N3O4S and a molecular weight of 487.48 g/mol. Its IUPAC name is N-[4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 26418691 |
| Molecular Formula | C21H21F4N3O4S |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | N-[4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | O=C(NCCCC(=O)N1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H21F4N3O4S/c22-14-3-5-16(18(25)12-14)21(30)26-7-1-2-20(29)27-8-10-28(11-9-27)33(31,32)19-13-15(23)4-6-17(19)24/h3-6,12-13H,1-2,7-11H2,(H,26,30) |
| InChIKey | LXJCBBMOFCHJST-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|