C15H19F2N3O2 — CID 119411680
N-[4-[(3R)-3-aminopyrrolidin-1-yl]-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 119411680) has the molecular formula C15H19F2N3O2 and a molecular weight of 311.33 g/mol. Its IUPAC name is N-[4-[(3R)-3-aminopyrrolidin-1-yl]-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-[(3R)-3-aminopyrrolidin-1-yl]-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 119411680 |
| Molecular Formula | C15H19F2N3O2 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | N-[4-[(3R)-3-aminopyrrolidin-1-yl]-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | N[C@@H]1CCN(C(=O)CCCNC(=O)c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C15H19F2N3O2/c16-10-3-4-12(13(17)8-10)15(22)19-6-1-2-14(21)20-7-5-11(18)9-20/h3-4,8,11H,1-2,5-7,9,18H2,(H,19,22)/t11-/m1/s1 |
| InChIKey | RZVAWFWVSQFJSE-LLVKDONJSA-N |
| XLogP | 1.03 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|