C17H24ClF2N3O2 — CID 119423550
N-[4-[4-(aminomethyl)piperidin-1-yl]-4-oxobutyl]-2,4-difluorobenzamide;hydrochloride (PubChem CID 119423550) has the molecular formula C17H24ClF2N3O2 and a molecular weight of 375.85 g/mol. Its IUPAC name is N-[4-[4-(aminomethyl)piperidin-1-yl]-4-oxobutyl]-2,4-difluorobenzamide;hydrochloride.
| Compound Name | N-[4-[4-(aminomethyl)piperidin-1-yl]-4-oxobutyl]-2,4-difluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119423550 |
| Molecular Formula | C17H24ClF2N3O2 |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-[4-[4-(aminomethyl)piperidin-1-yl]-4-oxobutyl]-2,4-difluorobenzamide;hydrochloride |
| SMILES | Cl.NCC1CCN(C(=O)CCCNC(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C17H23F2N3O2.ClH/c18-13-3-4-14(15(19)10-13)17(24)21-7-1-2-16(23)22-8-5-12(11-20)6-9-22;/h3-4,10,12H,1-2,5-9,11,20H2,(H,21,24);1H |
| InChIKey | QPNQUDGGGSBRTF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|