C17H22F2N2O2 — CID 51192571
2,4-difluoro-N-[4-(3-methylpiperidin-1-yl)-4-oxobutyl]benzamide (PubChem CID 51192571) has the molecular formula C17H22F2N2O2 and a molecular weight of 324.37 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-(3-methylpiperidin-1-yl)-4-oxobutyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-(3-methylpiperidin-1-yl)-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 51192571 |
| Molecular Formula | C17H22F2N2O2 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2,4-difluoro-N-[4-(3-methylpiperidin-1-yl)-4-oxobutyl]benzamide |
| SMILES | CC1CCCN(C(=O)CCCNC(=O)c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C17H22F2N2O2/c1-12-4-3-9-21(11-12)16(22)5-2-8-20-17(23)14-7-6-13(18)10-15(14)19/h6-7,10,12H,2-5,8-9,11H2,1H3,(H,20,23) |
| InChIKey | XHQJFAXVFANQQI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|