C16H21F2N3O2 — CID 119485573
N-[4-[3-(aminomethyl)pyrrolidin-1-yl]-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 119485573) has the molecular formula C16H21F2N3O2 and a molecular weight of 325.36 g/mol. Its IUPAC name is N-[4-[3-(aminomethyl)pyrrolidin-1-yl]-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-[3-(aminomethyl)pyrrolidin-1-yl]-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 119485573 |
| Molecular Formula | C16H21F2N3O2 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N-[4-[3-(aminomethyl)pyrrolidin-1-yl]-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | NCC1CCN(C(=O)CCCNC(=O)c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C16H21F2N3O2/c17-12-3-4-13(14(18)8-12)16(23)20-6-1-2-15(22)21-7-5-11(9-19)10-21/h3-4,8,11H,1-2,5-7,9-10,19H2,(H,20,23) |
| InChIKey | WTSOFVDXGGDGBP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|