C20H27F2N3O2 — CID 134020823
N-[4-(4-cyclopentylpiperazin-1-yl)-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 134020823) has the molecular formula C20H27F2N3O2 and a molecular weight of 379.45 g/mol. Its IUPAC name is N-[4-(4-cyclopentylpiperazin-1-yl)-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-(4-cyclopentylpiperazin-1-yl)-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 134020823 |
| Molecular Formula | C20H27F2N3O2 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | N-[4-(4-cyclopentylpiperazin-1-yl)-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | O=C(NCCCC(=O)N1CCN(C2CCCC2)CC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H27F2N3O2/c21-15-7-8-17(18(22)14-15)20(27)23-9-3-6-19(26)25-12-10-24(11-13-25)16-4-1-2-5-16/h7-8,14,16H,1-6,9-13H2,(H,23,27) |
| InChIKey | GGVVKHDZQHYDAH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|