C19H27F2N3O2 — CID 55717928
2,4-difluoro-N-[4-[2-(4-methylpiperidin-1-yl)ethylamino]-4-oxobutyl]benzamide (PubChem CID 55717928) has the molecular formula C19H27F2N3O2 and a molecular weight of 367.44 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-[2-(4-methylpiperidin-1-yl)ethylamino]-4-oxobutyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-[2-(4-methylpiperidin-1-yl)ethylamino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 55717928 |
| Molecular Formula | C19H27F2N3O2 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 2,4-difluoro-N-[4-[2-(4-methylpiperidin-1-yl)ethylamino]-4-oxobutyl]benzamide |
| SMILES | CC1CCN(CCNC(=O)CCCNC(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C19H27F2N3O2/c1-14-6-10-24(11-7-14)12-9-22-18(25)3-2-8-23-19(26)16-5-4-15(20)13-17(16)21/h4-5,13-14H,2-3,6-12H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | BVYRUGAYUYVYEE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|