C18H26FN3O5S — CID 9046993
tert-butyl N-[3-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-3-oxopropyl]carbamate (PubChem CID 9046993) has the molecular formula C18H26FN3O5S and a molecular weight of 415.49 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 9046993 |
| Molecular Formula | C18H26FN3O5S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | tert-butyl N-[3-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)N1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H26FN3O5S/c1-18(2,3)27-17(24)20-9-8-16(23)21-10-12-22(13-11-21)28(25,26)15-7-5-4-6-14(15)19/h4-7H,8-13H2,1-3H3,(H,20,24) |
| InChIKey | NMPZIHURZDNFOD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |