C15H19FN2O5S2 — CID 18201955
methyl 2-[2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]sulfanylacetate (PubChem CID 18201955) has the molecular formula C15H19FN2O5S2 and a molecular weight of 390.46 g/mol. Its IUPAC name is methyl 2-[2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]sulfanylacetate.
| Compound Name | methyl 2-[2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]sulfanylacetate |
|---|---|
| PubChem CID | 18201955 |
| Molecular Formula | C15H19FN2O5S2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | methyl 2-[2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]sulfanylacetate |
| SMILES | COC(=O)CSCC(=O)N1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C15H19FN2O5S2/c1-23-15(20)11-24-10-14(19)17-6-8-18(9-7-17)25(21,22)13-5-3-2-4-12(13)16/h2-5H,6-11H2,1H3 |
| InChIKey | VCUMXNVZTLMLKW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |