C18H18BrFN2O3S2 — CID 4816176
2-(4-bromophenyl)sulfanyl-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 4816176) has the molecular formula C18H18BrFN2O3S2 and a molecular weight of 473.39 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-(4-bromophenyl)sulfanyl-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 4816176 |
| Molecular Formula | C18H18BrFN2O3S2 |
| Molecular Weight | 473.39 g/mol |
| Exact Mass | 471.99 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | O=C(CSc1ccc(Br)cc1)N1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H18BrFN2O3S2/c19-14-5-7-15(8-6-14)26-13-18(23)21-9-11-22(12-10-21)27(24,25)17-4-2-1-3-16(17)20/h1-8H,9-13H2 |
| InChIKey | KOPIXLPJLMLNLY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |