C23H32FN3O4 — CID 108919516
tert-butyl N-[3-[4-[[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]methyl]piperidin-1-yl]-3-oxopropyl]carbamate (PubChem CID 108919516) has the molecular formula C23H32FN3O4 and a molecular weight of 433.52 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]methyl]piperidin-1-yl]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]methyl]piperidin-1-yl]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108919516 |
| Molecular Formula | C23H32FN3O4 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | tert-butyl N-[3-[4-[[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]methyl]piperidin-1-yl]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)N1CCC(CNC(=O)/C=C/c2ccccc2F)CC1 |
| InChI | InChI=1S/C23H32FN3O4/c1-23(2,3)31-22(30)25-13-10-21(29)27-14-11-17(12-15-27)16-26-20(28)9-8-18-6-4-5-7-19(18)24/h4-9,17H,10-16H2,1-3H3,(H,25,30)(H,26,28)/b9-8+ |
| InChIKey | UZCXKLUDGRQQAH-CMDGGOBGSA-N |
| XLogP | 3.11 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|