C20H28FN3O4 — CID 108921699
tert-butyl N-[3-[3-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]propylamino]-3-oxopropyl]carbamate (PubChem CID 108921699) has the molecular formula C20H28FN3O4 and a molecular weight of 393.46 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]propylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]propylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108921699 |
| Molecular Formula | C20H28FN3O4 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | tert-butyl N-[3-[3-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]propylamino]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCCCNC(=O)/C=C/c1ccccc1F |
| InChI | InChI=1S/C20H28FN3O4/c1-20(2,3)28-19(27)24-14-11-18(26)23-13-6-12-22-17(25)10-9-15-7-4-5-8-16(15)21/h4-5,7-10H,6,11-14H2,1-3H3,(H,22,25)(H,23,26)(H,24,27)/b10-9+ |
| InChIKey | ITCMEQMOWYQZFV-MDZDMXLPSA-N |
| XLogP | 2.38 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|